Products 1262506-09-1
CAS 1262506-09-1 appears in our catalog under these names: Solifenacin EP Impurity F Succinate, (1R,3S)-Solifenacin Succinate. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 2,5mg, 25mg, 2mg, 1mg, 5mg, 10mg.
[(3S)-1-azabicyclo[2.2.2]octan-3-yl] (1R)-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate;butanedioic acid (CAS 1262506-09-1) is a chemical compound with the molecular formula C27H32N2O6 and a molecular weight of 480.6 g/mol. IUPAC name: [(3S)-1-azabicyclo[2.2.2]octan-3-yl] (1R)-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate;butanedioic acid. InChIKey: RXZMMZZRUPYENV-HLUKFBSCSA-N.
| Molecular formula | C27H32N2O6 |
|---|---|
| Molecular weight | 480.6 g/mol |
| IUPAC name | [(3S)-1-azabicyclo[2.2.2]octan-3-yl] (1R)-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate;butanedioic acid |
| InChIKey | RXZMMZZRUPYENV-HLUKFBSCSA-N |
| SMILES | C1CN2CCC1[C@@H](C2)OC(=O)N3CCC4=CC=CC=C4[C@H]3C5=CC=CC=C5.C(CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(1R,3S)-Solifenacin Succinate