Products 862207-70-3
CAS 862207-70-3 appears in our catalog under these names: (R,R)-Solifenacin succinate, 95%, Solifenacin EP Impurity G Succinate, (R,R)-Solifenacin Succinate, >95% (HPLC), (R,R)-Solifenacin succinate. Offered by: Combi-blocks, Chemat Brand, TRC, Biosynth. Available pack sizes: 100mg, 250mg, on request, 10mg, 50mg, 500mg.
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] (1R)-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate;butanedioic acid (CAS 862207-70-3) is a chemical compound with the molecular formula C27H32N2O6 and a molecular weight of 480.6 g/mol. IUPAC name: [(3R)-1-azabicyclo[2.2.2]octan-3-yl] (1R)-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate;butanedioic acid. InChIKey: RXZMMZZRUPYENV-UMIAIAFLSA-N.
| Molecular formula | C27H32N2O6 |
|---|---|
| Molecular weight | 480.6 g/mol |
| IUPAC name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] (1R)-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate;butanedioic acid |
| InChIKey | RXZMMZZRUPYENV-UMIAIAFLSA-N |
| SMILES | C1CN2CCC1[C@H](C2)OC(=O)N3CCC4=CC=CC=C4[C@H]3C5=CC=CC=C5.C(CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)