CAS 1262534-81-5 is the registry number for {4-((3-Fluorophenoxy)methyl)phenyl}methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
[4-[(3-fluorophenoxy)methyl]phenyl]methanamine;hydrochloride (CAS 1262534-81-5) is a chemical compound with the molecular formula C14H15ClFNO and a molecular weight of 267.72 g/mol. IUPAC name: [4-[(3-fluorophenoxy)methyl]phenyl]methanamine;hydrochloride. InChIKey: ZMXIKWDBRYVHPY-UHFFFAOYSA-N.
| Molecular formula | C14H15ClFNO |
|---|---|
| Molecular weight | 267.72 g/mol |
| IUPAC name | [4-[(3-fluorophenoxy)methyl]phenyl]methanamine;hydrochloride |
| InChIKey | ZMXIKWDBRYVHPY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)OCC2=CC=C(C=C2)CN.Cl |
Computed by PubChem (NCBI)