Products 2138519-32-9
CAS 2138519-32-9 appears in our catalog under these names: 1-(4-(4-Fluorophenoxy)phenyl)ethan-1-amine hydrochloride, 1-[4-(4-fluorophenoxy)phenyl]ethan-1-amine hydrochloride. Offered by: Biosynth, Chemat. Available pack sizes: 2,5g, 250mg, 100mg.
1-[4-(4-fluorophenoxy)phenyl]ethanamine;hydrochloride (CAS 2138519-32-9) is a chemical compound with the molecular formula C14H15ClFNO and a molecular weight of 267.72 g/mol. IUPAC name: 1-[4-(4-fluorophenoxy)phenyl]ethanamine;hydrochloride. InChIKey: AMBAXUBRURQXGR-UHFFFAOYSA-N.
| Molecular formula | C14H15ClFNO |
|---|---|
| Molecular weight | 267.72 g/mol |
| IUPAC name | 1-[4-(4-fluorophenoxy)phenyl]ethanamine;hydrochloride |
| InChIKey | AMBAXUBRURQXGR-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)OC2=CC=C(C=C2)F)N.Cl |
Computed by PubChem (NCBI)