CAS 126262-78-0 appears in our catalog under these names: 1-(Carboxymethyl)-4,5-dimethyl-1h-imidazole 3-oxide, 95%, 1-(Carboxymethyl)-4,5-dimethyl-1H-imidazole 3-oxide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
2-(4,5-dimethyl-3-oxidoimidazol-3-ium-1-yl)acetic acid (CAS 126262-78-0) is a chemical compound with the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. IUPAC name: 2-(4,5-dimethyl-3-oxidoimidazol-3-ium-1-yl)acetic acid. InChIKey: QUHKASGGNUOSPC-UHFFFAOYSA-N.
| Molecular formula | C7H10N2O3 |
|---|---|
| Molecular weight | 170.17 g/mol |
| IUPAC name | 2-(4,5-dimethyl-3-oxidoimidazol-3-ium-1-yl)acetic acid |
| InChIKey | QUHKASGGNUOSPC-UHFFFAOYSA-N |
| SMILES | CC1=C([N+](=CN1CC(=O)O)[O-])C |
Computed by PubChem (NCBI)