CAS 1262751-42-7 appears in our catalog under these names: [(1S)-1-(5-Methyl-4h-1,2,4-triazol-3-yl)ethyl]amine dihydrochloride, 95%, (1S)-1-(5-Methyl-4H-1,2,4-triazol-3-yl)ethan-1-amine dihydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 25g, 10g, 50g, 1g, 5g.
(1S)-1-(5-methyl-1H-1,2,4-triazol-3-yl)ethanamine;dihydrochloride (CAS 1262751-42-7) is a chemical compound with the molecular formula C5H12Cl2N4 and a molecular weight of 199.08 g/mol. IUPAC name: (1S)-1-(5-methyl-1H-1,2,4-triazol-3-yl)ethanamine;dihydrochloride. InChIKey: VUKQBFLHDHDODR-QTNFYWBSSA-N.
| Molecular formula | C5H12Cl2N4 |
|---|---|
| Molecular weight | 199.08 g/mol |
| IUPAC name | (1S)-1-(5-methyl-1H-1,2,4-triazol-3-yl)ethanamine;dihydrochloride |
| InChIKey | VUKQBFLHDHDODR-QTNFYWBSSA-N |
| SMILES | CC1=NC(=NN1)[C@H](C)N.Cl.Cl |
Computed by PubChem (NCBI)