CAS 2343964-29-2 is the registry number for (1R)-1-(5-Methyl-1h-1,2,4-triazol-3-yl)ethan-1-amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(1R)-1-(5-methyl-1H-1,2,4-triazol-3-yl)ethanamine;dihydrochloride (CAS 2343964-29-2) is a chemical compound with the molecular formula C5H12Cl2N4 and a molecular weight of 199.08 g/mol. IUPAC name: (1R)-1-(5-methyl-1H-1,2,4-triazol-3-yl)ethanamine;dihydrochloride. InChIKey: VUKQBFLHDHDODR-HWYNEVGZSA-N.
| Molecular formula | C5H12Cl2N4 |
|---|---|
| Molecular weight | 199.08 g/mol |
| IUPAC name | (1R)-1-(5-methyl-1H-1,2,4-triazol-3-yl)ethanamine;dihydrochloride |
| InChIKey | VUKQBFLHDHDODR-HWYNEVGZSA-N |
| SMILES | CC1=NC(=NN1)[C@@H](C)N.Cl.Cl |
Computed by PubChem (NCBI)