Products 1262770-67-1
CAS 1262770-67-1 appears in our catalog under these names: Propionylpromazine-d6 Hydrochloride, >95% (HPLC), Propionylpromazine–d6 hydrochloride, Propionylpromazine-d6 (hydrochloride), 99%, 99%, Propionylpromazine-d6 (hydrochloride), 99.78%, D6-Propionylpromazine hydrochloride, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, GLPBio, Chemat, MedChemExpress, HPC Standards. Available pack sizes: 10mg, 1mg, 5mg, 1 mg, 10 mg, 5 mg, 1x1ml, 1x10mg.
1-[10-[3-[bis(trideuteriomethyl)amino]propyl]phenothiazin-2-yl]propan-1-one;hydrochloride (CAS 1262770-67-1) is a chemical compound with the molecular formula C20H25ClN2OS and a molecular weight of 383.0 g/mol. IUPAC name: 1-[10-[3-[bis(trideuteriomethyl)amino]propyl]phenothiazin-2-yl]propan-1-one;hydrochloride. InChIKey: ZFWVWZODBGTOIL-HVTBMTIBSA-N.
| Molecular formula | C20H25ClN2OS |
|---|---|
| Molecular weight | 383.0 g/mol |
| IUPAC name | 1-[10-[3-[bis(trideuteriomethyl)amino]propyl]phenothiazin-2-yl]propan-1-one;hydrochloride |
| InChIKey | ZFWVWZODBGTOIL-HVTBMTIBSA-N |
| SMILES | [2H]C([2H])([2H])N(CCCN1C2=CC=CC=C2SC3=C1C=C(C=C3)C(=O)CC)C([2H])([2H])[2H].Cl |
Computed by PubChem (NCBI)