CAS 7681-67-6 appears in our catalog under these names: Propionylpromazine Hydrochloride, Propionylpromazine hydrochloride/ 99.17% (existing batch purity), Propionylpromazine hydrochloride, Propionylpromazine (hydrochloride), 99.17% ,, 99.17% ,, Propionylpromazine (hydrochloride) (Standard). Offered by: TRC, Dr. Ehrenstorfer, TargetMol, GLPBio, Chemat. Available pack sizes: 100mg, 1g, 250mg, 25mg, 1mg, 5mg, 10mg, 50mg.
1-[10-[3-(dimethylamino)propyl]phenothiazin-2-yl]propan-1-one;hydrochloride (CAS 7681-67-6) is a chemical compound with the molecular formula C20H25ClN2OS and a molecular weight of 376.9 g/mol. IUPAC name: 1-[10-[3-(dimethylamino)propyl]phenothiazin-2-yl]propan-1-one;hydrochloride. InChIKey: ZFWVWZODBGTOIL-UHFFFAOYSA-N.
| Molecular formula | C20H25ClN2OS |
|---|---|
| Molecular weight | 376.9 g/mol |
| IUPAC name | 1-[10-[3-(dimethylamino)propyl]phenothiazin-2-yl]propan-1-one;hydrochloride |
| InChIKey | ZFWVWZODBGTOIL-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=CC2=C(C=C1)SC3=CC=CC=C3N2CCCN(C)C.Cl |
Computed by PubChem (NCBI)