CAS 1262778-55-1 appears in our catalog under these names: Fesoterodine Impurity 18, Fesoterodine Impurity 5. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
3-[3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(2-methylpropanoyloxy)benzoic acid (CAS 1262778-55-1) is a chemical compound with the molecular formula C26H35NO4 and a molecular weight of 425.6 g/mol. IUPAC name: 3-[3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(2-methylpropanoyloxy)benzoic acid. InChIKey: XGHMZCHFAYDLGS-UHFFFAOYSA-N.
| Molecular formula | C26H35NO4 |
|---|---|
| Molecular weight | 425.6 g/mol |
| IUPAC name | 3-[3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(2-methylpropanoyloxy)benzoic acid |
| InChIKey | XGHMZCHFAYDLGS-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)OC1=C(C=C(C=C1)C(=O)O)C(CCN(C(C)C)C(C)C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)