Products 1391913-28-2
CAS 1391913-28-2 is the registry number for (R)-Fesoterodine Fumarate Impurity E. Offered by: TRC. Available pack sizes: 250mg.
3-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(2-methylpropanoyloxy)benzoic acid (CAS 1391913-28-2) is a chemical compound with the molecular formula C26H35NO4 and a molecular weight of 425.6 g/mol. IUPAC name: 3-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(2-methylpropanoyloxy)benzoic acid. InChIKey: XGHMZCHFAYDLGS-JOCHJYFZSA-N.
| Molecular formula | C26H35NO4 |
|---|---|
| Molecular weight | 425.6 g/mol |
| IUPAC name | 3-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(2-methylpropanoyloxy)benzoic acid |
| InChIKey | XGHMZCHFAYDLGS-JOCHJYFZSA-N |
| SMILES | CC(C)C(=O)OC1=C(C=C(C=C1)C(=O)O)[C@H](CCN(C(C)C)C(C)C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)