CAS 1262858-70-7 is the registry number for tert-Butyl (5-(3-bromophenyl)-5-methyl-5,6-dihydro-2H-1,4-oxazin-3-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[5-(3-bromophenyl)-5-methyl-2,6-dihydro-1,4-oxazin-3-yl]carbamate (CAS 1262858-70-7) is a chemical compound with the molecular formula C16H21BrN2O3 and a molecular weight of 369.25 g/mol. IUPAC name: tert-butyl N-[5-(3-bromophenyl)-5-methyl-2,6-dihydro-1,4-oxazin-3-yl]carbamate. InChIKey: MDISWQRNYLCKFU-UHFFFAOYSA-N.
| Molecular formula | C16H21BrN2O3 |
|---|---|
| Molecular weight | 369.25 g/mol |
| IUPAC name | tert-butyl N-[5-(3-bromophenyl)-5-methyl-2,6-dihydro-1,4-oxazin-3-yl]carbamate |
| InChIKey | MDISWQRNYLCKFU-UHFFFAOYSA-N |
| SMILES | CC1(COCC(=N1)NC(=O)OC(C)(C)C)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)