CAS 2260727-68-0 is the registry number for Ethyl (S)-4-amino-6-bromospiro[chromane-2,4'-piperidine]-1'-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (4S)-4-amino-6-bromospiro[3,4-dihydrochromene-2,4'-piperidine]-1'-carboxylate (CAS 2260727-68-0) is a chemical compound with the molecular formula C16H21BrN2O3 and a molecular weight of 369.25 g/mol. IUPAC name: ethyl (4S)-4-amino-6-bromospiro[3,4-dihydrochromene-2,4'-piperidine]-1'-carboxylate. InChIKey: OTKVOUQHJRVRBF-ZDUSSCGKSA-N.
| Molecular formula | C16H21BrN2O3 |
|---|---|
| Molecular weight | 369.25 g/mol |
| IUPAC name | ethyl (4S)-4-amino-6-bromospiro[3,4-dihydrochromene-2,4'-piperidine]-1'-carboxylate |
| InChIKey | OTKVOUQHJRVRBF-ZDUSSCGKSA-N |
| SMILES | CCOC(=O)N1CCC2(CC1)C[C@@H](C3=C(O2)C=CC(=C3)Br)N |
Computed by PubChem (NCBI)