CAS 126301-17-5 is the registry number for (R)-2-((tert-Butoxycarbonyl)amino)propyl methanesulfonate, 98%. Offered by: AmBeed. Available pack sizes: 5g.
[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] methanesulfonate (CAS 126301-17-5) is a chemical compound with the molecular formula C9H19NO5S and a molecular weight of 253.32 g/mol. IUPAC name: [(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] methanesulfonate. InChIKey: NLKBUJQLMRHSKP-SSDOTTSWSA-N.
| Molecular formula | C9H19NO5S |
|---|---|
| Molecular weight | 253.32 g/mol |
| IUPAC name | [(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] methanesulfonate |
| InChIKey | NLKBUJQLMRHSKP-SSDOTTSWSA-N |
| SMILES | C[C@H](COS(=O)(=O)C)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)