CAS 14810-93-6 appears in our catalog under these names: Lincomycin Impurity 6(Lincomycin EP Impurity F), Lincomycin EP Impurity F, Lincomycin Hydrochloride EP Impurity F, (2R,3R,4S,5R,6R)-2-((1R,2R)-1-Amino-2-hydroxypropyl)-6-(methylthio)tetrahydro-2H-pyran-3,4,5-triol, 98%, Methyl 1-Thiolincosaminide, >95% (HPLC). Offered by: Hubei YoungXin, Chemat Brand, TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request, 5mg, 2mg.
(2R,3R,4S,5R,6R)-2-[(1R,2R)-1-amino-2-hydroxypropyl]-6-methylsulfanyloxane-3,4,5-triol (CAS 14810-93-6) is a chemical compound with the molecular formula C9H19NO5S and a molecular weight of 253.32 g/mol. IUPAC name: (2R,3R,4S,5R,6R)-2-[(1R,2R)-1-amino-2-hydroxypropyl]-6-methylsulfanyloxane-3,4,5-triol. InChIKey: AEEIMWYSDWZKAT-HJTGYUAHSA-N.
| Molecular formula | C9H19NO5S |
|---|---|
| Molecular weight | 253.32 g/mol |
| IUPAC name | (2R,3R,4S,5R,6R)-2-[(1R,2R)-1-amino-2-hydroxypropyl]-6-methylsulfanyloxane-3,4,5-triol |
| InChIKey | AEEIMWYSDWZKAT-HJTGYUAHSA-N |
| SMILES | C[C@H]([C@H]([C@@H]1[C@@H]([C@@H]([C@H]([C@H](O1)SC)O)O)O)N)O |
Computed by PubChem (NCBI)