Products 1263046-44-1
CAS 1263046-44-1 appears in our catalog under these names: 4-Trans-[(boc)2-guanidino]cyclohexane carboxylic acid, 95%, 4-trans-((Boc)2-guanidino)cyclohexane carboxylic acid, 97%, (Boc)2-4-trans-GCHC-OH, 4-Trans-[(boc)2-guanidino]cyclohexane carboxylic acid, 98%, 98%, 4-trans-[(Boc)2-guanidino]cyclohexane carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed, Iris Biotech, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]cyclohexane-1-carboxylic acid (CAS 1263046-44-1) is a chemical compound with the molecular formula C18H31N3O6 and a molecular weight of 385.5 g/mol. IUPAC name: 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]cyclohexane-1-carboxylic acid. InChIKey: IQUNZZZNJUCWCG-UHFFFAOYSA-N.
| Molecular formula | C18H31N3O6 |
|---|---|
| Molecular weight | 385.5 g/mol |
| IUPAC name | 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]cyclohexane-1-carboxylic acid |
| InChIKey | IQUNZZZNJUCWCG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(=NC1CCC(CC1)C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)