Products 134448-10-5
CAS 134448-10-5 appears in our catalog under these names: CA 074, Ca-074, 95%, CA 074/ 97.8% (existing batch purity), Cathepsin B Inhibitor III , L-trans-Epoxysuccinyl-Ile-Pro-OH propylamide. Offered by: GLPBio, Combi-blocks, TargetMol, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 10mg, 5mg, 250mg, 100mg, 1g, 1mg, 25mg, 50mg.
(2S)-1-[(2S,3S)-2-[[(3S)-3-hydroxy-4-oxo-4-(propylamino)butanoyl]amino]-3-methylpentanoyl]pyrrolidine-2-carboxylic acid (CAS 134448-10-5) is a chemical compound with the molecular formula C18H31N3O6 and a molecular weight of 385.5 g/mol. IUPAC name: (2S)-1-[(2S,3S)-2-[[(3S)-3-hydroxy-4-oxo-4-(propylamino)butanoyl]amino]-3-methylpentanoyl]pyrrolidine-2-carboxylic acid. InChIKey: UDNIFTKCMDIXFC-ABHRYQDASA-N.
| Molecular formula | C18H31N3O6 |
|---|---|
| Molecular weight | 385.5 g/mol |
| IUPAC name | (2S)-1-[(2S,3S)-2-[[(3S)-3-hydroxy-4-oxo-4-(propylamino)butanoyl]amino]-3-methylpentanoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | UDNIFTKCMDIXFC-ABHRYQDASA-N |
| SMILES | CCCNC(=O)[C@H](CC(=O)N[C@@H]([C@@H](C)CC)C(=O)N1CCC[C@H]1C(=O)O)O |
Computed by PubChem (NCBI)