Products 1263047-22-8
CAS 1263047-22-8 appears in our catalog under these names: Fmoc-L-Dab(Dnp)-OH, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-((2,4-dinitrophenyl)amino)butanoic acid, 97%. Offered by: Iris Biotech, Chemat. Available pack sizes: 1g, 5g, 25g, 100mg, 250mg, 500mg.
(2S)-4-(2,4-dinitroanilino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (CAS 1263047-22-8) is a chemical compound with the molecular formula C25H22N4O8 and a molecular weight of 506.5 g/mol. IUPAC name: (2S)-4-(2,4-dinitroanilino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid. InChIKey: HBHWAVNNODKLBE-QFIPXVFZSA-N.
| Molecular formula | C25H22N4O8 |
|---|---|
| Molecular weight | 506.5 g/mol |
| IUPAC name | (2S)-4-(2,4-dinitroanilino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| InChIKey | HBHWAVNNODKLBE-QFIPXVFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCNC4=C(C=C(C=C4)[N+](=O)[O-])[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)