Products 1263047-25-1
CAS 1263047-25-1 is the registry number for Fmoc-D-Dab(Dnp)-OH. Offered by: Iris Biotech. Available pack sizes: 1g, 100mg, 250mg.
(2R)-4-(2,4-dinitroanilino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (CAS 1263047-25-1) is a chemical compound with the molecular formula C25H22N4O8 and a molecular weight of 506.5 g/mol. IUPAC name: (2R)-4-(2,4-dinitroanilino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid. InChIKey: HBHWAVNNODKLBE-JOCHJYFZSA-N.
| Molecular formula | C25H22N4O8 |
|---|---|
| Molecular weight | 506.5 g/mol |
| IUPAC name | (2R)-4-(2,4-dinitroanilino)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| InChIKey | HBHWAVNNODKLBE-JOCHJYFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CCNC4=C(C=C(C=C4)[N+](=O)[O-])[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)