CAS 1263048-23-2 is the registry number for tert-Butyl 2-carbamoyl-4,4-difluoropyrrolidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2-carbamoyl-4,4-difluoropyrrolidine-1-carboxylate (CAS 1263048-23-2) is a chemical compound with the molecular formula C10H16F2N2O3 and a molecular weight of 250.24 g/mol. IUPAC name: tert-butyl 2-carbamoyl-4,4-difluoropyrrolidine-1-carboxylate. InChIKey: FBQFSNRSVLFGLE-UHFFFAOYSA-N.
| Molecular formula | C10H16F2N2O3 |
|---|---|
| Molecular weight | 250.24 g/mol |
| IUPAC name | tert-butyl 2-carbamoyl-4,4-difluoropyrrolidine-1-carboxylate |
| InChIKey | FBQFSNRSVLFGLE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(CC1C(=O)N)(F)F |
Computed by PubChem (NCBI)