CAS 426844-50-0 appears in our catalog under these names: Boc-4,4-difluoro-l-prolinamide, 95%, (S)-tert-Butyl 2-carbamoyl-4,4-difluoropyrrolidine-1-carboxylate 95%, Boc-4,4-Difluoro-L-prolinamide, 95%, 95%, (S)-tert-Butyl 2-carbamoyl-4,4-difluoropyrrolidine-1-carboxylate, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
Tert-butyl (2S)-2-carbamoyl-4,4-difluoropyrrolidine-1-carboxylate (CAS 426844-50-0) is a chemical compound with the molecular formula C10H16F2N2O3 and a molecular weight of 250.24 g/mol. IUPAC name: tert-butyl (2S)-2-carbamoyl-4,4-difluoropyrrolidine-1-carboxylate. InChIKey: FBQFSNRSVLFGLE-LURJTMIESA-N.
| Molecular formula | C10H16F2N2O3 |
|---|---|
| Molecular weight | 250.24 g/mol |
| IUPAC name | tert-butyl (2S)-2-carbamoyl-4,4-difluoropyrrolidine-1-carboxylate |
| InChIKey | FBQFSNRSVLFGLE-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C[C@H]1C(=O)N)(F)F |
Computed by PubChem (NCBI)