CAS 1263077-95-7 is the registry number for (S)-tert-Butyl 3-(dimethylamino)pyrrolidine-1-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl (3S)-3-(dimethylamino)pyrrolidine-1-carboxylate (CAS 1263077-95-7) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl (3S)-3-(dimethylamino)pyrrolidine-1-carboxylate. InChIKey: SOFNSBHMEVBTNR-VIFPVBQESA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl (3S)-3-(dimethylamino)pyrrolidine-1-carboxylate |
| InChIKey | SOFNSBHMEVBTNR-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](C1)N(C)C |
Computed by PubChem (NCBI)