CAS 1263089-45-7 is the registry number for Des-3-(3,5-Dichlorophenyl) Dicloromezotiaz. Offered by: TRC. Available pack sizes: 1g.
N-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-methylpyridin-2-amine (CAS 1263089-45-7) is a chemical compound with the molecular formula C10H10ClN3S and a molecular weight of 239.73 g/mol. IUPAC name: N-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-methylpyridin-2-amine. InChIKey: FPKKPPXMUGIKKC-UHFFFAOYSA-N.
| Molecular formula | C10H10ClN3S |
|---|---|
| Molecular weight | 239.73 g/mol |
| IUPAC name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-methylpyridin-2-amine |
| InChIKey | FPKKPPXMUGIKKC-UHFFFAOYSA-N |
| SMILES | CC1=C(N=CC=C1)NCC2=CN=C(S2)Cl |
Computed by PubChem (NCBI)