Products 1263090-98-7
CAS 1263090-98-7 appears in our catalog under these names: alpha-Terpinenol-D6, α-Terpineol-d6, D6-alpha-Terpineol, ISO 17034 RM. Offered by: TRC, MedChemExpress, HPC Standards. Available pack sizes: 25mg, 1 mg, 10mg.
1,1,1,3,3,3-hexadeuterio-2-(4-methylcyclohex-3-en-1-yl)propan-2-ol (CAS 1263090-98-7) is a chemical compound with the molecular formula C10H18O and a molecular weight of 160.29 g/mol. IUPAC name: 1,1,1,3,3,3-hexadeuterio-2-(4-methylcyclohex-3-en-1-yl)propan-2-ol. InChIKey: WUOACPNHFRMFPN-XERRXZQWSA-N.
| Molecular formula | C10H18O |
|---|---|
| Molecular weight | 160.29 g/mol |
| IUPAC name | 1,1,1,3,3,3-hexadeuterio-2-(4-methylcyclohex-3-en-1-yl)propan-2-ol |
| InChIKey | WUOACPNHFRMFPN-XERRXZQWSA-N |
| SMILES | [2H]C([2H])([2H])C(C1CCC(=CC1)C)(C([2H])([2H])[2H])O |
Computed by PubChem (NCBI)