Products 203633-12-9
CAS 203633-12-9 appears in our catalog under these names: alpha-Terpineol-d3 (propyl methyl-d3), 98 atom % D, min 98% Chemical Purity, Alpha-Terpineol-d3 (Propyl Methyl-d3), >95% (GC), α-Terpineol-d3, 98.14%, D3-alpha-Terpineol, ISO 17034 RM. Offered by: CDN, TRC, MedChemExpress, HPC Standards. Available pack sizes: 0,1g, 0,05g, 100mg, 10mg, 50mg, 10 mg.
1,1,1-trideuterio-2-[(1S)-4-methylcyclohex-3-en-1-yl]propan-2-ol (CAS 203633-12-9) is a chemical compound with the molecular formula C10H18O and a molecular weight of 157.27 g/mol. IUPAC name: 1,1,1-trideuterio-2-[(1S)-4-methylcyclohex-3-en-1-yl]propan-2-ol. InChIKey: WUOACPNHFRMFPN-DPIUJBPVSA-N.
| Molecular formula | C10H18O |
|---|---|
| Molecular weight | 157.27 g/mol |
| IUPAC name | 1,1,1-trideuterio-2-[(1S)-4-methylcyclohex-3-en-1-yl]propan-2-ol |
| InChIKey | WUOACPNHFRMFPN-DPIUJBPVSA-N |
| SMILES | [2H]C([2H])([2H])C(C)([C@H]1CCC(=CC1)C)O |
Computed by PubChem (NCBI)