CAS 1263094-82-1 appears in our catalog under these names: (S)-3-Amino-2,2-difluoro-3-(4-methoxy-phenyl)-propionic acid hydrochloride, 97%, (S)-3-Amino-2,2-difluoro-3-(4-methoxyphenyl)propanoic acid hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
(3S)-3-amino-2,2-difluoro-3-(4-methoxyphenyl)propanoic acid;hydrochloride (CAS 1263094-82-1) is a chemical compound with the molecular formula C10H12ClF2NO3 and a molecular weight of 267.66 g/mol. IUPAC name: (3S)-3-amino-2,2-difluoro-3-(4-methoxyphenyl)propanoic acid;hydrochloride. InChIKey: SXDPBCLPVWWZGD-QRPNPIFTSA-N.
| Molecular formula | C10H12ClF2NO3 |
|---|---|
| Molecular weight | 267.66 g/mol |
| IUPAC name | (3S)-3-amino-2,2-difluoro-3-(4-methoxyphenyl)propanoic acid;hydrochloride |
| InChIKey | SXDPBCLPVWWZGD-QRPNPIFTSA-N |
| SMILES | COC1=CC=C(C=C1)[C@@H](C(C(=O)O)(F)F)N.Cl |
Computed by PubChem (NCBI)