Products 2241138-24-7
CAS 2241138-24-7 is the registry number for 2-Amino-2-(4-(2,2-difluoroethoxy)phenyl)acetic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-amino-2-[4-(2,2-difluoroethoxy)phenyl]acetic acid;hydrochloride (CAS 2241138-24-7) is a chemical compound with the molecular formula C10H12ClF2NO3 and a molecular weight of 267.66 g/mol. IUPAC name: 2-amino-2-[4-(2,2-difluoroethoxy)phenyl]acetic acid;hydrochloride. InChIKey: PXMYEHCIOPACPA-UHFFFAOYSA-N.
| Molecular formula | C10H12ClF2NO3 |
|---|---|
| Molecular weight | 267.66 g/mol |
| IUPAC name | 2-amino-2-[4-(2,2-difluoroethoxy)phenyl]acetic acid;hydrochloride |
| InChIKey | PXMYEHCIOPACPA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(=O)O)N)OCC(F)F.Cl |
Computed by PubChem (NCBI)