CAS 126312-31-0 is the registry number for Desmethyl Metsulfuron-methyl, >95% (HPLC). Offered by: TRC. Available pack sizes: 500mg, 50mg.
Methyl 2-[(2-methyl-6-oxo-1H-1,3,5-triazin-4-yl)carbamoylsulfamoyl]benzoate (CAS 126312-31-0) is a chemical compound with the molecular formula C13H13N5O6S and a molecular weight of 367.34 g/mol. IUPAC name: methyl 2-[(2-methyl-6-oxo-1H-1,3,5-triazin-4-yl)carbamoylsulfamoyl]benzoate. InChIKey: XCRRTPZSEWGCGA-UHFFFAOYSA-N.
| Molecular formula | C13H13N5O6S |
|---|---|
| Molecular weight | 367.34 g/mol |
| IUPAC name | methyl 2-[(2-methyl-6-oxo-1H-1,3,5-triazin-4-yl)carbamoylsulfamoyl]benzoate |
| InChIKey | XCRRTPZSEWGCGA-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NC(=O)N1)NC(=O)NS(=O)(=O)C2=CC=CC=C2C(=O)OC |
Computed by PubChem (NCBI)