CAS 79510-48-8 appears in our catalog under these names: 2-(N-((4-Methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoyl)sulfamoyl)benzoic acid, 97%, Metsulfuron, >95% (HPLC), Metsulfuron, Metsulfuron, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, HPC Standards. Available pack sizes: on request, 100mg, 10mg, 1x10mg, 1x1ml.
2-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoylsulfamoyl]benzoic acid (CAS 79510-48-8) is a chemical compound with the molecular formula C13H13N5O6S and a molecular weight of 367.34 g/mol. IUPAC name: 2-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoylsulfamoyl]benzoic acid. InChIKey: UWHURBUBIHUHSU-UHFFFAOYSA-N.
| Molecular formula | C13H13N5O6S |
|---|---|
| Molecular weight | 367.34 g/mol |
| IUPAC name | 2-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoylsulfamoyl]benzoic acid |
| InChIKey | UWHURBUBIHUHSU-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NC(=N1)OC)NC(=O)NS(=O)(=O)C2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)