CAS 1263179-33-4 is the registry number for 3-Bromo-1-(difluoromethyl)pyridin-2(1H)-one, 98%. Offered by: AmBeed. Available pack sizes: 5g.
3-bromo-1-(difluoromethyl)pyridin-2-one (CAS 1263179-33-4) is a chemical compound with the molecular formula C6H4BrF2NO and a molecular weight of 224.00 g/mol. IUPAC name: 3-bromo-1-(difluoromethyl)pyridin-2-one. InChIKey: AVZMVLBYVKPAAY-UHFFFAOYSA-N.
| Molecular formula | C6H4BrF2NO |
|---|---|
| Molecular weight | 224.00 g/mol |
| IUPAC name | 3-bromo-1-(difluoromethyl)pyridin-2-one |
| InChIKey | AVZMVLBYVKPAAY-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=O)C(=C1)Br)C(F)F |
Computed by PubChem (NCBI)