CAS 2725749-76-6 is the registry number for 4-Amino-3-bromo-2,6-difluorophenol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-3-bromo-2,6-difluorophenol (CAS 2725749-76-6) is a chemical compound with the molecular formula C6H4BrF2NO and a molecular weight of 224.00 g/mol. IUPAC name: 4-amino-3-bromo-2,6-difluorophenol. InChIKey: JGGWEJVJQBQFNB-UHFFFAOYSA-N.
| Molecular formula | C6H4BrF2NO |
|---|---|
| Molecular weight | 224.00 g/mol |
| IUPAC name | 4-amino-3-bromo-2,6-difluorophenol |
| InChIKey | JGGWEJVJQBQFNB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)O)F)Br)N |
Computed by PubChem (NCBI)