Products 1263202-08-9
CAS 1263202-08-9 is the registry number for methyl 3-(4-bromophenyl)-3-hydroxybutanoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 3-(4-bromophenyl)-3-hydroxybutanoate (CAS 1263202-08-9) is a chemical compound with the molecular formula C11H13BrO3 and a molecular weight of 273.12 g/mol. IUPAC name: methyl 3-(4-bromophenyl)-3-hydroxybutanoate. InChIKey: BHECSAIUMKCIPS-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO3 |
|---|---|
| Molecular weight | 273.12 g/mol |
| IUPAC name | methyl 3-(4-bromophenyl)-3-hydroxybutanoate |
| InChIKey | BHECSAIUMKCIPS-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)OC)(C1=CC=C(C=C1)Br)O |
Computed by PubChem (NCBI)