CAS 1263274-69-6 is the registry number for N,N-Dimethyl-1-benzothiophene-2-sulfonamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
N,N-dimethyl-1-benzothiophene-2-sulfonamide (CAS 1263274-69-6) is a chemical compound with the molecular formula C10H11NO2S2 and a molecular weight of 241.3 g/mol. IUPAC name: N,N-dimethyl-1-benzothiophene-2-sulfonamide. InChIKey: VUMZYYOZOBFSOP-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2S2 |
|---|---|
| Molecular weight | 241.3 g/mol |
| IUPAC name | N,N-dimethyl-1-benzothiophene-2-sulfonamide |
| InChIKey | VUMZYYOZOBFSOP-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC2=CC=CC=C2S1 |
Computed by PubChem (NCBI)