Products 85716-85-4

CAS 85716-85-4 is the registry number for Ethyl 2-isothiocyanato-4,5-dimethylthiophene-3-carboxylate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 2-isothiocyanato-4,5-dimethylthiophene-3-carboxylate (CAS 85716-85-4) is a chemical compound with the molecular formula C10H11NO2S2 and a molecular weight of 241.3 g/mol. IUPAC name: ethyl 2-isothiocyanato-4,5-dimethylthiophene-3-carboxylate. InChIKey: ONDWCCQQWAIQRH-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11NO2S2
Molecular weight241.3 g/mol
IUPAC nameethyl 2-isothiocyanato-4,5-dimethylthiophene-3-carboxylate
InChIKeyONDWCCQQWAIQRH-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(SC(=C1C)C)N=C=S

Computed by PubChem (NCBI)