CAS 1263284-35-0 is the registry number for tert-Butyl 2-amino-4-hydroxy-5H,6H,7H-pyrrolo(3,4-d)pyrimidine-6-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl 2-amino-4-oxo-5,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-6-carboxylate (CAS 1263284-35-0) is a chemical compound with the molecular formula C11H16N4O3 and a molecular weight of 252.27 g/mol. IUPAC name: tert-butyl 2-amino-4-oxo-5,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-6-carboxylate. InChIKey: JHRXQHJAKLHVSJ-UHFFFAOYSA-N.
| Molecular formula | C11H16N4O3 |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | tert-butyl 2-amino-4-oxo-5,7-dihydro-3H-pyrrolo[3,4-d]pyrimidine-6-carboxylate |
| InChIKey | JHRXQHJAKLHVSJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C1)N=C(NC2=O)N |
Computed by PubChem (NCBI)