CAS 1263296-82-7 appears in our catalog under these names: 5-Amino-2-diphenylmethyl-2-azaspiro[3.3]heptane, 95%, 2–BENZHYDRYL–2–AZASPIRO(3·3)HEPTAN–5–AMINE. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g.
2-benzhydryl-2-azaspiro[3.3]heptan-7-amine (CAS 1263296-82-7) is a chemical compound with the molecular formula C19H22N2 and a molecular weight of 278.4 g/mol. IUPAC name: 2-benzhydryl-2-azaspiro[3.3]heptan-7-amine. InChIKey: DSZKDNIUEMPRKJ-UHFFFAOYSA-N.
| Molecular formula | C19H22N2 |
|---|---|
| Molecular weight | 278.4 g/mol |
| IUPAC name | 2-benzhydryl-2-azaspiro[3.3]heptan-7-amine |
| InChIKey | DSZKDNIUEMPRKJ-UHFFFAOYSA-N |
| SMILES | C1CC2(C1N)CN(C2)C(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)