CAS 1263376-63-1 is the registry number for 3-Bromo-4-fluorophenylthiourea, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
(3-bromo-4-fluorophenyl)thiourea (CAS 1263376-63-1) is a chemical compound with the molecular formula C7H6BrFN2S and a molecular weight of 249.11 g/mol. IUPAC name: (3-bromo-4-fluorophenyl)thiourea. InChIKey: WVARUNLSZJFYGG-UHFFFAOYSA-N.
| Molecular formula | C7H6BrFN2S |
|---|---|
| Molecular weight | 249.11 g/mol |
| IUPAC name | (3-bromo-4-fluorophenyl)thiourea |
| InChIKey | WVARUNLSZJFYGG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC(=S)N)Br)F |
Computed by PubChem (NCBI)