CAS 930396-07-9 is the registry number for 1-(4-Bromo-2-fluorophenyl)thiourea, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
(4-bromo-2-fluorophenyl)thiourea (CAS 930396-07-9) is a chemical compound with the molecular formula C7H6BrFN2S and a molecular weight of 249.11 g/mol. IUPAC name: (4-bromo-2-fluorophenyl)thiourea. InChIKey: GOWRWGYTXLKMHG-UHFFFAOYSA-N.
| Molecular formula | C7H6BrFN2S |
|---|---|
| Molecular weight | 249.11 g/mol |
| IUPAC name | (4-bromo-2-fluorophenyl)thiourea |
| InChIKey | GOWRWGYTXLKMHG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)F)NC(=S)N |
Computed by PubChem (NCBI)