CAS 1263376-99-3 appears in our catalog under these names: 3-Bromo-2-iodo-5-methoxynitrobenzene, 95+%, 3-Bromo-2-iodo-5-methoxynitrobenzene, 95%. Offered by: AmBeed, Fluorochem. Available pack sizes: 25g, 1g.
1-bromo-2-iodo-5-methoxy-3-nitrobenzene (CAS 1263376-99-3) is a chemical compound with the molecular formula C7H5BrINO3 and a molecular weight of 357.93 g/mol. IUPAC name: 1-bromo-2-iodo-5-methoxy-3-nitrobenzene. InChIKey: APJYPPWBWCHKCJ-UHFFFAOYSA-N.
| Molecular formula | C7H5BrINO3 |
|---|---|
| Molecular weight | 357.93 g/mol |
| IUPAC name | 1-bromo-2-iodo-5-methoxy-3-nitrobenzene |
| InChIKey | APJYPPWBWCHKCJ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)Br)I)[N+](=O)[O-] |
Computed by PubChem (NCBI)