CAS 1361021-39-7 is the registry number for 2-Bromo-5-iodo-4-nitroanisole, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-bromo-4-iodo-2-methoxy-5-nitrobenzene (CAS 1361021-39-7) is a chemical compound with the molecular formula C7H5BrINO3 and a molecular weight of 357.93 g/mol. IUPAC name: 1-bromo-4-iodo-2-methoxy-5-nitrobenzene. InChIKey: LIQQFDPRYUYNMP-UHFFFAOYSA-N.
| Molecular formula | C7H5BrINO3 |
|---|---|
| Molecular weight | 357.93 g/mol |
| IUPAC name | 1-bromo-4-iodo-2-methoxy-5-nitrobenzene |
| InChIKey | LIQQFDPRYUYNMP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)I)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)