CAS 1263386-32-8 is the registry number for Ethyl 6-chloro-4-(trifluoromethyl)quinoline-2-carboxylate, 90%. Offered by: AmBeed. Available pack sizes: 1g.
Ethyl 6-chloro-4-(trifluoromethyl)quinoline-2-carboxylate (CAS 1263386-32-8) is a chemical compound with the molecular formula C13H9ClF3NO2 and a molecular weight of 303.66 g/mol. IUPAC name: ethyl 6-chloro-4-(trifluoromethyl)quinoline-2-carboxylate. InChIKey: MLUQDYXYTIQLLY-UHFFFAOYSA-N.
| Molecular formula | C13H9ClF3NO2 |
|---|---|
| Molecular weight | 303.66 g/mol |
| IUPAC name | ethyl 6-chloro-4-(trifluoromethyl)quinoline-2-carboxylate |
| InChIKey | MLUQDYXYTIQLLY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC2=C(C=C(C=C2)Cl)C(=C1)C(F)(F)F |
Computed by PubChem (NCBI)