Products 126371-43-5
CAS 126371-43-5 appears in our catalog under these names: Atropine Impurity 4（Atropine EP Impurity D）, Hyoscyamine Sulfate Impurity 2（Hyoscyamine Sulfate EP Impurity B）. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
[(1S,3R,5S,6R)-6-hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] (2S)-3-hydroxy-2-phenylpropanoate (CAS 126371-43-5) is a chemical compound with the molecular formula C17H23NO4 and a molecular weight of 305.4 g/mol. IUPAC name: [(1S,3R,5S,6R)-6-hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] (2S)-3-hydroxy-2-phenylpropanoate. InChIKey: WTQYWNWRJNXDEG-DGXTUMSLSA-N.
| Molecular formula | C17H23NO4 |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | [(1S,3R,5S,6R)-6-hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] (2S)-3-hydroxy-2-phenylpropanoate |
| InChIKey | WTQYWNWRJNXDEG-DGXTUMSLSA-N |
| SMILES | CN1[C@@H]2C[C@H](C[C@H]1[C@@H](C2)O)OC(=O)[C@H](CO)C3=CC=CC=C3 |
Computed by PubChem (NCBI)
Synonyms:
(+)-Anisodamine