CAS 949092-65-3? appears in our catalog under these names: Atropine EP Impurity E (Mixture of Diastereomers) (7-Hydroxyhyoscyamine), Atropine sulfate EP Impurity E, 7-Hydroxyhyoscyamine. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 5mg, 2mg, 10mg, 50mg, 25mg.
[(1S,3R,5S)-6-hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] (2S)-3-hydroxy-2-phenylpropanoate (CAS 949092-65-3) is a chemical compound with the molecular formula C17H23NO4 and a molecular weight of 305.4 g/mol. IUPAC name: [(1S,3R,5S)-6-hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] (2S)-3-hydroxy-2-phenylpropanoate. InChIKey: WTQYWNWRJNXDEG-YFVFXCHESA-N.
| Molecular formula | C17H23NO4 |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | [(1S,3R,5S)-6-hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] (2S)-3-hydroxy-2-phenylpropanoate |
| InChIKey | WTQYWNWRJNXDEG-YFVFXCHESA-N |
| SMILES | CN1[C@@H]2C[C@H](C[C@H]1C(C2)O)OC(=O)[C@H](CO)C3=CC=CC=C3 |
Computed by PubChem (NCBI)