Products 1263819-48-2
CAS 1263819-48-2 appears in our catalog under these names: NH2-Ph-C4-acid-NH2-Me, 98%, NH2–Ph–C4–acid–NH2–Me, NH2-Ph-C4-acid-NH2-Me. Offered by: Chemat Brand, GLPBio, MedChemExpress. Available pack sizes: on request, 1mg, 5mg, Get quote.
(2S,4R)-4-amino-5-(4-aminophenyl)-2-methylpentanoic acid (CAS 1263819-48-2) is a chemical compound with the molecular formula C12H18N2O2 and a molecular weight of 222.28 g/mol. IUPAC name: (2S,4R)-4-amino-5-(4-aminophenyl)-2-methylpentanoic acid. InChIKey: JPGXUEFAQWNCEO-GZMMTYOYSA-N.
| Molecular formula | C12H18N2O2 |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | (2S,4R)-4-amino-5-(4-aminophenyl)-2-methylpentanoic acid |
| InChIKey | JPGXUEFAQWNCEO-GZMMTYOYSA-N |
| SMILES | C[C@@H](C[C@H](CC1=CC=C(C=C1)N)N)C(=O)O |
Computed by PubChem (NCBI)