CAS 1264511-59-2 is the registry number for (6–(thiazol–4–yl)pyridin–3–yl)boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg.
[6-(1,3-thiazol-4-yl)-3-pyridinyl]boronic acid (CAS 1264511-59-2) is a chemical compound with the molecular formula C8H7BN2O2S and a molecular weight of 206.03 g/mol. IUPAC name: [6-(1,3-thiazol-4-yl)-3-pyridinyl]boronic acid. InChIKey: UXTGJMPVULPNHV-UHFFFAOYSA-N.
| Molecular formula | C8H7BN2O2S |
|---|---|
| Molecular weight | 206.03 g/mol |
| IUPAC name | [6-(1,3-thiazol-4-yl)-3-pyridinyl]boronic acid |
| InChIKey | UXTGJMPVULPNHV-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(C=C1)C2=CSC=N2)(O)O |
Computed by PubChem (NCBI)