CAS 2225172-17-6 is the registry number for (2–(thiophen–2–yl)pyrimidin–5–yl)boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
(2-thiophen-2-ylpyrimidin-5-yl)boronic acid (CAS 2225172-17-6) is a chemical compound with the molecular formula C8H7BN2O2S and a molecular weight of 206.03 g/mol. IUPAC name: (2-thiophen-2-ylpyrimidin-5-yl)boronic acid. InChIKey: JUASIXBVMXKEPI-UHFFFAOYSA-N.
| Molecular formula | C8H7BN2O2S |
|---|---|
| Molecular weight | 206.03 g/mol |
| IUPAC name | (2-thiophen-2-ylpyrimidin-5-yl)boronic acid |
| InChIKey | JUASIXBVMXKEPI-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(N=C1)C2=CC=CS2)(O)O |
Computed by PubChem (NCBI)