CAS 126473-61-8 is the registry number for (E)-CHBO4, 97.04%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 50 mg.
(E)-1-(4-bromophenyl)-3-(4-fluorophenyl)prop-2-en-1-one (CAS 126473-61-8) is a chemical compound with the molecular formula C15H10BrFO and a molecular weight of 305.14 g/mol. IUPAC name: (E)-1-(4-bromophenyl)-3-(4-fluorophenyl)prop-2-en-1-one. InChIKey: JLKQXQSMJJGERH-XCVCLJGOSA-N.
| Molecular formula | C15H10BrFO |
|---|---|
| Molecular weight | 305.14 g/mol |
| IUPAC name | (E)-1-(4-bromophenyl)-3-(4-fluorophenyl)prop-2-en-1-one |
| InChIKey | JLKQXQSMJJGERH-XCVCLJGOSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C(=O)C2=CC=C(C=C2)Br)F |
Computed by PubChem (NCBI)