Products 1264837-96-8

CAS 1264837-96-8 is the registry number for 1-Phenyl-2-piperazinone trifluoroacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

1-phenylpiperazin-2-one;2,2,2-trifluoroacetic acid (CAS 1264837-96-8) is a chemical compound with the molecular formula C12H13F3N2O3 and a molecular weight of 290.24 g/mol. IUPAC name: 1-phenylpiperazin-2-one;2,2,2-trifluoroacetic acid. InChIKey: ARSFMZLXWWVUFB-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13F3N2O3
Molecular weight290.24 g/mol
IUPAC name1-phenylpiperazin-2-one;2,2,2-trifluoroacetic acid
InChIKeyARSFMZLXWWVUFB-UHFFFAOYSA-N
SMILESC1CN(C(=O)CN1)C2=CC=CC=C2.C(=O)(C(F)(F)F)O

Computed by PubChem (NCBI)