CAS 1305324-88-2 is the registry number for 2-Pivalamido-5-(trifluoromethyl)nicotinic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-(2,2-dimethylpropanoylamino)-5-(trifluoromethyl)pyridine-3-carboxylic acid (CAS 1305324-88-2) is a chemical compound with the molecular formula C12H13F3N2O3 and a molecular weight of 290.24 g/mol. IUPAC name: 2-(2,2-dimethylpropanoylamino)-5-(trifluoromethyl)pyridine-3-carboxylic acid. InChIKey: JUHGLODVLUZCDX-UHFFFAOYSA-N.
| Molecular formula | C12H13F3N2O3 |
|---|---|
| Molecular weight | 290.24 g/mol |
| IUPAC name | 2-(2,2-dimethylpropanoylamino)-5-(trifluoromethyl)pyridine-3-carboxylic acid |
| InChIKey | JUHGLODVLUZCDX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=C(C=C(C=N1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)