Products 1266157-97-4
CAS 1266157-97-4 is the registry number for 1-(5-Chloro-3-fluoropyridin-2-yl)cyclopropan-1-amine. Offered by: TRC. Available pack sizes: 500mg.
1-(5-chloro-3-fluoro-2-pyridinyl)cyclopropan-1-amine (CAS 1266157-97-4) is a chemical compound with the molecular formula C8H8ClFN2 and a molecular weight of 186.61 g/mol. IUPAC name: 1-(5-chloro-3-fluoro-2-pyridinyl)cyclopropan-1-amine. InChIKey: HSJSUKUTWFKXEE-UHFFFAOYSA-N.
| Molecular formula | C8H8ClFN2 |
|---|---|
| Molecular weight | 186.61 g/mol |
| IUPAC name | 1-(5-chloro-3-fluoro-2-pyridinyl)cyclopropan-1-amine |
| InChIKey | HSJSUKUTWFKXEE-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=C(C=C(C=N2)Cl)F)N |
Computed by PubChem (NCBI)